C18H21F2NO6 — CID 68796639
methyl 4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxycarbonylamino]but-2-enoate (PubChem CID 68796639) has the molecular formula C18H21F2NO6 and a molecular weight of 385.36 g/mol. Its IUPAC name is methyl 4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxycarbonylamino]but-2-enoate.
| Compound Name | methyl 4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxycarbonylamino]but-2-enoate |
|---|---|
| PubChem CID | 68796639 |
| Molecular Formula | C18H21F2NO6 |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | methyl 4,4-difluoro-2-[(2-methylpropan-2-yl)oxycarbonyl-phenylmethoxycarbonylamino]but-2-enoate |
| SMILES | COC(=O)C(=CC(F)F)N(C(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H21F2NO6/c1-18(2,3)27-17(24)21(13(10-14(19)20)15(22)25-4)16(23)26-11-12-8-6-5-7-9-12/h5-10,14H,11H2,1-4H3 |
| InChIKey | WYOVFKJNDQOGFX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|