C13H13F2NO4 — CID 76653882
methyl 4,4-difluoro-2-(phenylmethoxycarbonylamino)but-2-enoate (PubChem CID 76653882) has the molecular formula C13H13F2NO4 and a molecular weight of 285.25 g/mol. Its IUPAC name is methyl 4,4-difluoro-2-(phenylmethoxycarbonylamino)but-2-enoate.
| Compound Name | methyl 4,4-difluoro-2-(phenylmethoxycarbonylamino)but-2-enoate |
|---|---|
| PubChem CID | 76653882 |
| Molecular Formula | C13H13F2NO4 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | methyl 4,4-difluoro-2-(phenylmethoxycarbonylamino)but-2-enoate |
| SMILES | COC(=O)C(=CC(F)F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H13F2NO4/c1-19-12(17)10(7-11(14)15)16-13(18)20-8-9-5-3-2-4-6-9/h2-7,11H,8H2,1H3,(H,16,18) |
| InChIKey | CZAYNFRYHSOFAA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|