C12H19N5O — CID 102144249
3-methoxy-N,N-bis(pyrazol-1-ylmethyl)propan-1-amine (PubChem CID 102144249) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-methoxy-N,N-bis(pyrazol-1-ylmethyl)propan-1-amine.
| Compound Name | 3-methoxy-N,N-bis(pyrazol-1-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 102144249 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3-methoxy-N,N-bis(pyrazol-1-ylmethyl)propan-1-amine |
| SMILES | COCCCN(Cn1cccn1)Cn1cccn1 |
| InChI | InChI=1S/C12H19N5O/c1-18-10-4-7-15(11-16-8-2-5-13-16)12-17-9-3-6-14-17/h2-3,5-6,8-9H,4,7,10-12H2,1H3 |
| InChIKey | QFEPZUWNTMEHQZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|