C11H22O5 — CID 102144558
(4S,5R,6R)-5,6-bis(methoxymethoxy)hept-1-en-4-ol (PubChem CID 102144558) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is (4S,5R,6R)-5,6-bis(methoxymethoxy)hept-1-en-4-ol.
| Compound Name | (4S,5R,6R)-5,6-bis(methoxymethoxy)hept-1-en-4-ol |
|---|---|
| PubChem CID | 102144558 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (4S,5R,6R)-5,6-bis(methoxymethoxy)hept-1-en-4-ol |
| SMILES | C=CC[C@H](O)[C@@H](OCOC)[C@@H](C)OCOC |
| InChI | InChI=1S/C11H22O5/c1-5-6-10(12)11(16-8-14-4)9(2)15-7-13-3/h5,9-12H,1,6-8H2,2-4H3/t9-,10+,11+/m1/s1 |
| InChIKey | JXWARBJSKGKDKU-VWYCJHECSA-N |
| XLogP | 0.92 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|