C13H26O3 — CID 11322182
(4S,5S)-5-(methoxymethoxy)undec-1-en-4-ol (PubChem CID 11322182) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (4S,5S)-5-(methoxymethoxy)undec-1-en-4-ol.
| Compound Name | (4S,5S)-5-(methoxymethoxy)undec-1-en-4-ol |
|---|---|
| PubChem CID | 11322182 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (4S,5S)-5-(methoxymethoxy)undec-1-en-4-ol |
| SMILES | C=CC[C@H](O)[C@H](CCCCCC)OCOC |
| InChI | InChI=1S/C13H26O3/c1-4-6-7-8-10-13(16-11-15-3)12(14)9-5-2/h5,12-14H,2,4,6-11H2,1,3H3/t12-,13-/m0/s1 |
| InChIKey | XVZSAUJJDWILRK-STQMWFEESA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|