C15H28O3 — CID 72708008
(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octan-1-ol (PubChem CID 72708008) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octan-1-ol.
| Compound Name | (1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octan-1-ol |
|---|---|
| PubChem CID | 72708008 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octan-1-ol |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1[C@H](O)CCCCCCC |
| InChI | InChI=1S/C15H28O3/c1-5-7-8-9-10-11-12(16)14-13(6-2)17-15(3,4)18-14/h6,12-14,16H,2,5,7-11H2,1,3-4H3/t12-,13+,14-/m1/s1 |
| InChIKey | UAUBLHVKQIZEBQ-HZSPNIEDSA-N |
| XLogP | 3.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|