C25H44O6 — CID 102144807
trimethyl (2R,3R)-3-[(E)-non-1-enyl]decane-1,2,10-tricarboxylate (PubChem CID 102144807) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is trimethyl (2R,3R)-3-[(E)-non-1-enyl]decane-1,2,10-tricarboxylate.
| Compound Name | trimethyl (2R,3R)-3-[(E)-non-1-enyl]decane-1,2,10-tricarboxylate |
|---|---|
| PubChem CID | 102144807 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | trimethyl (2R,3R)-3-[(E)-non-1-enyl]decane-1,2,10-tricarboxylate |
| SMILES | CCCCCCC/C=C/[C@@H](CCCCCCCC(=O)OC)[C@@H](CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C25H44O6/c1-5-6-7-8-9-11-14-17-21(22(25(28)31-4)20-24(27)30-3)18-15-12-10-13-16-19-23(26)29-2/h14,17,21-22H,5-13,15-16,18-20H2,1-4H3/b17-14+/t21-,22+/m0/s1 |
| InChIKey | CYUYUFGZJAADQZ-OFCZRXAKSA-N |
| XLogP | 5.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|