C41H62O3 — CID 102147094
[(8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-pentylbenzoate (PubChem CID 102147094) has the molecular formula C41H62O3 and a molecular weight of 602.94 g/mol. Its IUPAC name is [(8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-pentylbenzoate.
| Compound Name | [(8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-pentylbenzoate |
|---|---|
| PubChem CID | 102147094 |
| Molecular Formula | C41H62O3 |
| Molecular Weight | 602.94 g/mol |
| Exact Mass | 602.47 |
| IUPAC Name | [(8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-pentylbenzoate |
| SMILES | CCCCCc1ccc(C(=O)OC2CC[C@@]3(C)C(=CC(=O)[C@H]4[C@@H]5CC[C@H]([C@H](C)CC[C@@H](CC)C(C)C)[C@@]5(C)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C41H62O3/c1-8-10-11-12-29-14-17-31(18-15-29)39(43)44-33-21-23-40(6)32(25-33)26-37(42)38-35-20-19-34(41(35,7)24-22-36(38)40)28(5)13-16-30(9-2)27(3)4/h14-15,17-18,26-28,30,33-36,38H,8-13,16,19-25H2,1-7H3/t28-,30-,33?,34-,35+,36+,38+,40+,41-/m1/s1 |
| InChIKey | NAXFIWTYVIZLMV-VMPVTFELSA-N |
| XLogP | 10.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.94 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|