C18H24O4 — CID 102147178
[(E)-7-[(2R)-1-hydroxybut-3-en-2-yl]oxyhept-5-enyl] benzoate (PubChem CID 102147178) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is [(E)-7-[(2R)-1-hydroxybut-3-en-2-yl]oxyhept-5-enyl] benzoate.
| Compound Name | [(E)-7-[(2R)-1-hydroxybut-3-en-2-yl]oxyhept-5-enyl] benzoate |
|---|---|
| PubChem CID | 102147178 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [(E)-7-[(2R)-1-hydroxybut-3-en-2-yl]oxyhept-5-enyl] benzoate |
| SMILES | C=C[C@H](CO)OC/C=C/CCCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24O4/c1-2-17(15-19)21-13-9-4-3-5-10-14-22-18(20)16-11-7-6-8-12-16/h2,4,6-9,11-12,17,19H,1,3,5,10,13-15H2/b9-4+/t17-/m1/s1 |
| InChIKey | HDPJDGCLSNVWKX-MDGVGCGJSA-N |
| XLogP | 3.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|