C36H40N2O4P2 — CID 102147222
(E)-N,N'-dibenzyl-N,N'-bis[methyl(1-phenylethenoxy)phosphoryl]but-2-ene-1,4-diamine (PubChem CID 102147222) has the molecular formula C36H40N2O4P2 and a molecular weight of 626.67 g/mol. Its IUPAC name is (E)-N,N'-dibenzyl-N,N'-bis[methyl(1-phenylethenoxy)phosphoryl]but-2-ene-1,4-diamine.
| Compound Name | (E)-N,N'-dibenzyl-N,N'-bis[methyl(1-phenylethenoxy)phosphoryl]but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 102147222 |
| Molecular Formula | C36H40N2O4P2 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | (E)-N,N'-dibenzyl-N,N'-bis[methyl(1-phenylethenoxy)phosphoryl]but-2-ene-1,4-diamine |
| SMILES | C=C(OP(C)(=O)N(C/C=C/CN(Cc1ccccc1)P(C)(=O)OC(=C)c1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H40N2O4P2/c1-31(35-23-13-7-14-24-35)41-43(3,39)37(29-33-19-9-5-10-20-33)27-17-18-28-38(30-34-21-11-6-12-22-34)44(4,40)42-32(2)36-25-15-8-16-26-36/h5-26H,1-2,27-30H2,3-4H3/b18-17+ |
| InChIKey | XGFXURGGQQOWDJ-ISLYRVAYSA-N |
| XLogP | 9.57 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|