C40H52N2O4P2 — CID 139063837
(2S,4R,5S)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide;(2R,4S,5R)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 139063837) has the molecular formula C40H52N2O4P2 and a molecular weight of 686.81 g/mol. Its IUPAC name is (2S,4R,5S)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide;(2R,4S,5R)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | (2S,4R,5S)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide;(2R,4S,5R)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 139063837 |
| Molecular Formula | C40H52N2O4P2 |
| Molecular Weight | 686.81 g/mol |
| Exact Mass | 686.34 |
| IUPAC Name | (2S,4R,5S)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide;(2R,4S,5R)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | CC[P@@]1(=O)O[C@H](c2ccccc2)[C@H](c2ccccc2)N1C(C)(C)C.CC[P@]1(=O)O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/2C20H26NO2P/c2*1-5-24(22)21(20(2,3)4)18(16-12-8-6-9-13-16)19(23-24)17-14-10-7-11-15-17/h2*6-15,18-19H,5H2,1-4H3/t2*18-,19+,24+/m10/s1 |
| InChIKey | IAQYCOZZDARMLX-JCFFCMPXSA-N |
| XLogP | 11.63 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.81 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|