C20H26NO2P — CID 139063836
(2S,4S,5R)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 139063836) has the molecular formula C20H26NO2P and a molecular weight of 343.41 g/mol. Its IUPAC name is (2S,4S,5R)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | (2S,4S,5R)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 139063836 |
| Molecular Formula | C20H26NO2P |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (2S,4S,5R)-3-tert-butyl-2-ethyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | CC[P@]1(=O)O[C@H](c2ccccc2)[C@H](c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C20H26NO2P/c1-5-24(22)21(20(2,3)4)18(16-12-8-6-9-13-16)19(23-24)17-14-10-7-11-15-17/h6-15,18-19H,5H2,1-4H3/t18-,19+,24-/m0/s1 |
| InChIKey | TYQRNDWOXXRXAZ-GLDPYIMESA-N |
| XLogP | 5.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|