C30H30NO2P — CID 134885420
(4S,5R)-2-ethoxy-4-methyl-5-phenyl-3-trityl-1,3,2-oxazaphospholidine (PubChem CID 134885420) has the molecular formula C30H30NO2P and a molecular weight of 467.55 g/mol. Its IUPAC name is (4S,5R)-2-ethoxy-4-methyl-5-phenyl-3-trityl-1,3,2-oxazaphospholidine.
| Compound Name | (4S,5R)-2-ethoxy-4-methyl-5-phenyl-3-trityl-1,3,2-oxazaphospholidine |
|---|---|
| PubChem CID | 134885420 |
| Molecular Formula | C30H30NO2P |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (4S,5R)-2-ethoxy-4-methyl-5-phenyl-3-trityl-1,3,2-oxazaphospholidine |
| SMILES | CCOP1O[C@H](c2ccccc2)[C@H](C)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30NO2P/c1-3-32-34-31(24(2)29(33-34)25-16-8-4-9-17-25)30(26-18-10-5-11-19-26,27-20-12-6-13-21-27)28-22-14-7-15-23-28/h4-24,29H,3H2,1-2H3/t24-,29-,34?/m0/s1 |
| InChIKey | MUXGNOXQYCUFEH-MDOVHILFSA-N |
| XLogP | 7.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|