C23H32NO2P — CID 134977508
3-tert-butyl-2-(3-methylbutyl)-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 134977508) has the molecular formula C23H32NO2P and a molecular weight of 385.49 g/mol. Its IUPAC name is 3-tert-butyl-2-(3-methylbutyl)-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | 3-tert-butyl-2-(3-methylbutyl)-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 134977508 |
| Molecular Formula | C23H32NO2P |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 3-tert-butyl-2-(3-methylbutyl)-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | CC(C)CCP1(=O)OC(c2ccccc2)C(c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C23H32NO2P/c1-18(2)16-17-27(25)24(23(3,4)5)21(19-12-8-6-9-13-19)22(26-27)20-14-10-7-11-15-20/h6-15,18,21-22H,16-17H2,1-5H3 |
| InChIKey | XJDZMWZCNVMVFE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|