C31H30NO2P — CID 134978077
(2S,4S,5R)-4-methyl-5-phenyl-2-prop-2-enyl-3-trityl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 134978077) has the molecular formula C31H30NO2P and a molecular weight of 479.56 g/mol. Its IUPAC name is (2S,4S,5R)-4-methyl-5-phenyl-2-prop-2-enyl-3-trityl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | (2S,4S,5R)-4-methyl-5-phenyl-2-prop-2-enyl-3-trityl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 134978077 |
| Molecular Formula | C31H30NO2P |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (2S,4S,5R)-4-methyl-5-phenyl-2-prop-2-enyl-3-trityl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | C=CC[P@]1(=O)O[C@H](c2ccccc2)[C@H](C)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H30NO2P/c1-3-24-35(33)32(25(2)30(34-35)26-16-8-4-9-17-26)31(27-18-10-5-11-19-27,28-20-12-6-13-21-28)29-22-14-7-15-23-29/h3-23,25,30H,1,24H2,2H3/t25-,30-,35-/m0/s1 |
| InChIKey | UPFWLHOYQYNQRG-NKOFKNPBSA-N |
| XLogP | 7.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|