C39H35NOP2 — CID 11029321
(1R,2S)-N-diphenylphosphanyl-2-diphenylphosphanyloxy-N-methyl-1,2-diphenylethanamine (PubChem CID 11029321) has the molecular formula C39H35NOP2 and a molecular weight of 595.66 g/mol. Its IUPAC name is (1R,2S)-N-diphenylphosphanyl-2-diphenylphosphanyloxy-N-methyl-1,2-diphenylethanamine.
| Compound Name | (1R,2S)-N-diphenylphosphanyl-2-diphenylphosphanyloxy-N-methyl-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 11029321 |
| Molecular Formula | C39H35NOP2 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | (1R,2S)-N-diphenylphosphanyl-2-diphenylphosphanyloxy-N-methyl-1,2-diphenylethanamine |
| SMILES | CN([C@H](c1ccccc1)[C@@H](OP(c1ccccc1)c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H35NOP2/c1-40(42(34-24-12-4-13-25-34)35-26-14-5-15-27-35)38(32-20-8-2-9-21-32)39(33-22-10-3-11-23-33)41-43(36-28-16-6-17-29-36)37-30-18-7-19-31-37/h2-31,38-39H,1H3/t38-,39+/m1/s1 |
| InChIKey | QUNUCIXYSHOEQS-RGULYWFUSA-N |
| XLogP | 8.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|