C25H28NO2P — CID 134976792
2-benzyl-3-tert-butyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide (PubChem CID 134976792) has the molecular formula C25H28NO2P and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-benzyl-3-tert-butyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide.
| Compound Name | 2-benzyl-3-tert-butyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
|---|---|
| PubChem CID | 134976792 |
| Molecular Formula | C25H28NO2P |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-benzyl-3-tert-butyl-4,5-diphenyl-1,3,2λ5-oxazaphospholidine 2-oxide |
| SMILES | CC(C)(C)N1C(c2ccccc2)C(c2ccccc2)OP1(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H28NO2P/c1-25(2,3)26-23(21-15-9-5-10-16-21)24(22-17-11-6-12-18-22)28-29(26,27)19-20-13-7-4-8-14-20/h4-18,23-24H,19H2,1-3H3 |
| InChIKey | SKXASMVAPXSBAT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|