C19H19FO — CID 102147801
cis-(2R,5S)-2-benzyl-5-(3-fluorophenyl)cyclohexan-1-one (PubChem CID 102147801) has the molecular formula C19H19FO and a molecular weight of 282.36 g/mol. Its IUPAC name is cis-(2R,5S)-2-benzyl-5-(3-fluorophenyl)cyclohexan-1-one.
| Compound Name | cis-(2R,5S)-2-benzyl-5-(3-fluorophenyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 102147801 |
| Molecular Formula | C19H19FO |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | cis-(2R,5S)-2-benzyl-5-(3-fluorophenyl)cyclohexan-1-one |
| SMILES | O=C1C[C@@H](c2cccc(F)c2)CC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H19FO/c20-18-8-4-7-15(12-18)16-9-10-17(19(21)13-16)11-14-5-2-1-3-6-14/h1-8,12,16-17H,9-11,13H2/t16-,17+/m0/s1 |
| InChIKey | PKYXNVSLDLNOSR-DLBZAZTESA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |