C29H40ClNO4 — CID 102147837
2-[(Z,3R,4R)-9-chloro-4,8-dimethyl-1,4-bis(phenylmethoxy)non-8-en-3-yl]oxy-N,N-dimethylacetamide (PubChem CID 102147837) has the molecular formula C29H40ClNO4 and a molecular weight of 502.10 g/mol. Its IUPAC name is 2-[(Z,3R,4R)-9-chloro-4,8-dimethyl-1,4-bis(phenylmethoxy)non-8-en-3-yl]oxy-N,N-dimethylacetamide.
| Compound Name | 2-[(Z,3R,4R)-9-chloro-4,8-dimethyl-1,4-bis(phenylmethoxy)non-8-en-3-yl]oxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 102147837 |
| Molecular Formula | C29H40ClNO4 |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 2-[(Z,3R,4R)-9-chloro-4,8-dimethyl-1,4-bis(phenylmethoxy)non-8-en-3-yl]oxy-N,N-dimethylacetamide |
| SMILES | C/C(=C/Cl)CCC[C@@](C)(OCc1ccccc1)[C@@H](CCOCc1ccccc1)OCC(=O)N(C)C |
| InChI | InChI=1S/C29H40ClNO4/c1-24(20-30)12-11-18-29(2,35-22-26-15-9-6-10-16-26)27(34-23-28(32)31(3)4)17-19-33-21-25-13-7-5-8-14-25/h5-10,13-16,20,27H,11-12,17-19,21-23H2,1-4H3/b24-20-/t27-,29-/m1/s1 |
| InChIKey | QZGSNWSRMVLPJI-FIIJOWIQSA-N |
| XLogP | 6.36 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|