C23H30O4 — CID 102223085
(2S,4S,5S)-5-hydroxy-4,5-dimethyl-2,7-bis(phenylmethoxy)heptan-3-one (PubChem CID 102223085) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2S,4S,5S)-5-hydroxy-4,5-dimethyl-2,7-bis(phenylmethoxy)heptan-3-one.
| Compound Name | (2S,4S,5S)-5-hydroxy-4,5-dimethyl-2,7-bis(phenylmethoxy)heptan-3-one |
|---|---|
| PubChem CID | 102223085 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (2S,4S,5S)-5-hydroxy-4,5-dimethyl-2,7-bis(phenylmethoxy)heptan-3-one |
| SMILES | C[C@H](OCc1ccccc1)C(=O)[C@@H](C)[C@@](C)(O)CCOCc1ccccc1 |
| InChI | InChI=1S/C23H30O4/c1-18(22(24)19(2)27-17-21-12-8-5-9-13-21)23(3,25)14-15-26-16-20-10-6-4-7-11-20/h4-13,18-19,25H,14-17H2,1-3H3/t18-,19+,23+/m1/s1 |
| InChIKey | XTZUALLZERBSIT-MSYCTHLASA-N |
| XLogP | 4.15 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|