C30H27O12+ — CID 102147860
[7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 102147860) has the molecular formula C30H27O12+ and a molecular weight of 579.53 g/mol. Its IUPAC name is [7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102147860 |
| Molecular Formula | C30H27O12+ |
| Molecular Weight | 579.53 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | [7-hydroxy-2-(4-hydroxyphenyl)-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)cc1)Oc1cc2c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)cc2[o+]c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C30H26O12/c31-14-24-26(36)27(37)28(38)30(42-24)41-22-12-19(34)11-21-20(22)13-23(29(40-21)16-4-8-18(33)9-5-16)39-25(35)10-3-15-1-6-17(32)7-2-15/h1-13,24,26-28,30-31,36-38H,14H2,(H2-,32,33,34,35)/p+1/t24-,26-,27+,28-,30-/m1/s1 |
| InChIKey | CDGCGOINUJVHOU-SHPGVJHPSA-O |
| XLogP | 2.30 |
| TPSA | 197.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|