C31H29O14+ — CID 102320428
[2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-7-yl] 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 102320428) has the molecular formula C31H29O14+ and a molecular weight of 625.56 g/mol. Its IUPAC name is [2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-7-yl] 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-7-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102320428 |
| Molecular Formula | C31H29O14+ |
| Molecular Weight | 625.56 g/mol |
| Exact Mass | 625.16 |
| IUPAC Name | [2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-7-yl] 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | COc1cc(-c2[o+]c3cc(OC(=O)C=Cc4ccc(O)cc4)cc(O)c3cc2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc(O)c1O |
| InChI | InChI=1S/C31H28O14/c1-41-22-9-15(8-20(35)26(22)37)30-23(44-31-29(40)28(39)27(38)24(13-32)45-31)12-18-19(34)10-17(11-21(18)43-30)42-25(36)7-4-14-2-5-16(33)6-3-14/h2-12,24,27-29,31-32,38-40H,13H2,1H3,(H3-,33,34,35,36,37)/p+1/t24-,27-,28+,29-,31-/m1/s1 |
| InChIKey | PHNUWPILKUGDCX-VEZAKBLNSA-O |
| XLogP | 2.01 |
| TPSA | 227.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|