C11H12N3O4S2- — CID 102148462
2-amino-4-(4-methoxyphenyl)-1-methyl-5-sulfonatosulfanylimidazole (PubChem CID 102148462) has the molecular formula C11H12N3O4S2- and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-amino-4-(4-methoxyphenyl)-1-methyl-5-sulfonatosulfanylimidazole.
| Compound Name | 2-amino-4-(4-methoxyphenyl)-1-methyl-5-sulfonatosulfanylimidazole |
|---|---|
| PubChem CID | 102148462 |
| Molecular Formula | C11H12N3O4S2- |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-amino-4-(4-methoxyphenyl)-1-methyl-5-sulfonatosulfanylimidazole |
| SMILES | COc1ccc(-c2nc(N)n(C)c2SS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H13N3O4S2/c1-14-10(19-20(15,16)17)9(13-11(14)12)7-3-5-8(18-2)6-4-7/h3-6H,1-2H3,(H2,12,13)(H,15,16,17)/p-1 |
| InChIKey | CCJRKLGKLWSYTN-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 110.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|