C27H30O16 — CID 102148739
(2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-4,6-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-1-benzofuran-3-one (PubChem CID 102148739) has the molecular formula C27H30O16 and a molecular weight of 610.52 g/mol. Its IUPAC name is (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-4,6-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-4,6-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 102148739 |
| Molecular Formula | C27H30O16 |
| Molecular Weight | 610.52 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-4,6-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/c2ccc(O)c(O)c2)Oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C27H30O16/c28-7-16-20(33)22(35)24(37)26(42-16)39-10-5-13-18(19(32)15(40-13)4-9-1-2-11(30)12(31)3-9)14(6-10)41-27-25(38)23(36)21(34)17(8-29)43-27/h1-6,16-17,20-31,33-38H,7-8H2/b15-4-/t16-,17-,20-,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
| InChIKey | VKSREXJNZIANJD-ZDAXGADHSA-N |
| XLogP | -2.93 |
| TPSA | 265.52 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.52 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|