C21H20O9 — CID 163021953
4-hydroxy-2-[(4-hydroxyphenyl)methylidene]-6-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-1-benzofuran-3-one (PubChem CID 163021953) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is 4-hydroxy-2-[(4-hydroxyphenyl)methylidene]-6-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-1-benzofuran-3-one.
| Compound Name | 4-hydroxy-2-[(4-hydroxyphenyl)methylidene]-6-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-1-benzofuran-3-one |
|---|---|
| PubChem CID | 163021953 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 4-hydroxy-2-[(4-hydroxyphenyl)methylidene]-6-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-1-benzofuran-3-one |
| SMILES | C[C@@H]1O[C@H](Oc2cc(O)c3c(c2)OC(=Cc2ccc(O)cc2)C3=O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H20O9/c1-9-17(24)19(26)20(27)21(28-9)29-12-7-13(23)16-14(8-12)30-15(18(16)25)6-10-2-4-11(22)5-3-10/h2-9,17,19-24,26-27H,1H3/t9-,17-,19-,20-,21+/m0/s1 |
| InChIKey | ZWKNCUQZWIAEDC-LHOLCCHNSA-N |
| XLogP | 0.92 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|