C28H36O15 — CID 102149452
[(1S,4aR,5S,7aS)-1,5-bis[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl benzoate (PubChem CID 102149452) has the molecular formula C28H36O15 and a molecular weight of 612.58 g/mol. Its IUPAC name is [(1S,4aR,5S,7aS)-1,5-bis[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl benzoate.
| Compound Name | [(1S,4aR,5S,7aS)-1,5-bis[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl benzoate |
|---|---|
| PubChem CID | 102149452 |
| Molecular Formula | C28H36O15 |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | [(1S,4aR,5S,7aS)-1,5-bis[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-7-yl]methyl benzoate |
| SMILES | O=C(OCC1=C[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C=CO[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C28H36O15/c29-9-16-19(31)21(33)23(35)27(41-16)40-15-8-13(11-39-25(37)12-4-2-1-3-5-12)18-14(15)6-7-38-26(18)43-28-24(36)22(34)20(32)17(10-30)42-28/h1-8,14-24,26-36H,9-11H2/t14-,15+,16+,17+,18+,19+,20+,21-,22-,23+,24+,26-,27+,28-/m0/s1 |
| InChIKey | IEIJJNASDHISNV-XWBJPFMMSA-N |
| XLogP | -3.11 |
| TPSA | 234.29 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|