C12H18O3 — CID 102149648
ethyl (E)-3-[(3S,4R)-4-methylhexa-1,5-dien-3-yl]oxyprop-2-enoate (PubChem CID 102149648) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is ethyl (E)-3-[(3S,4R)-4-methylhexa-1,5-dien-3-yl]oxyprop-2-enoate.
| Compound Name | ethyl (E)-3-[(3S,4R)-4-methylhexa-1,5-dien-3-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 102149648 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | ethyl (E)-3-[(3S,4R)-4-methylhexa-1,5-dien-3-yl]oxyprop-2-enoate |
| SMILES | C=C[C@@H](C)[C@H](C=C)O/C=C/C(=O)OCC |
| InChI | InChI=1S/C12H18O3/c1-5-10(4)11(6-2)15-9-8-12(13)14-7-3/h5-6,8-11H,1-2,7H2,3-4H3/b9-8+/t10-,11+/m1/s1 |
| InChIKey | QPCAYKHVBGNKHY-OJLMFNQTSA-N |
| XLogP | 2.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|