C20H20ClNO3 — CID 102150813
(5aS,9aS)-5-benzyl-9a-chloro-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]quinoline-1,10-dione (PubChem CID 102150813) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is (5aS,9aS)-5-benzyl-9a-chloro-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]quinoline-1,10-dione.
| Compound Name | (5aS,9aS)-5-benzyl-9a-chloro-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]quinoline-1,10-dione |
|---|---|
| PubChem CID | 102150813 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (5aS,9aS)-5-benzyl-9a-chloro-3-methyl-6,7,8,9-tetrahydro-5aH-pyrano[4,3-b]quinoline-1,10-dione |
| SMILES | Cc1cc2c(c(=O)o1)C(=O)[C@]1(Cl)CCCC[C@@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C20H20ClNO3/c1-13-11-15-17(19(24)25-13)18(23)20(21)10-6-5-9-16(20)22(15)12-14-7-3-2-4-8-14/h2-4,7-8,11,16H,5-6,9-10,12H2,1H3/t16-,20-/m0/s1 |
| InChIKey | GXFVJVDUKOYSBG-JXFKEZNVSA-N |
| XLogP | 4.07 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|