C18H20N2O3 — CID 10403238
(2R,5S,6R)-8-benzyl-5,11-dimethyl-4,12-dioxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-dien-13-one (PubChem CID 10403238) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (2R,5S,6R)-8-benzyl-5,11-dimethyl-4,12-dioxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-dien-13-one.
| Compound Name | (2R,5S,6R)-8-benzyl-5,11-dimethyl-4,12-dioxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-dien-13-one |
|---|---|
| PubChem CID | 10403238 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2R,5S,6R)-8-benzyl-5,11-dimethyl-4,12-dioxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-dien-13-one |
| SMILES | Cc1cc2c(c(=O)o1)[C@@H]1NO[C@@H](C)[C@@H]1CN2Cc1ccccc1 |
| InChI | InChI=1S/C18H20N2O3/c1-11-8-15-16(18(21)22-11)17-14(12(2)23-19-17)10-20(15)9-13-6-4-3-5-7-13/h3-8,12,14,17,19H,9-10H2,1-2H3/t12-,14-,17+/m0/s1 |
| InChIKey | BCESEUDFSVPBKD-RVSPLBMKSA-N |
| XLogP | 2.55 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |