C12H18O — CID 102150887
(5E)-4-[(1E)-buta-1,3-dienyl]octa-5,7-dien-1-ol (PubChem CID 102150887) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (5E)-4-[(1E)-buta-1,3-dienyl]octa-5,7-dien-1-ol.
| Compound Name | (5E)-4-[(1E)-buta-1,3-dienyl]octa-5,7-dien-1-ol |
|---|---|
| PubChem CID | 102150887 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (5E)-4-[(1E)-buta-1,3-dienyl]octa-5,7-dien-1-ol |
| SMILES | C=C/C=C/C(/C=C/C=C)CCCO |
| InChI | InChI=1S/C12H18O/c1-3-5-8-12(9-6-4-2)10-7-11-13/h3-6,8-9,12-13H,1-2,7,10-11H2/b8-5+,9-6+ |
| InChIKey | NYENSHDBYKSHFQ-XVYDYJIPSA-N |
| XLogP | 2.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|