C6H8Br2 — CID 90770193
5,6-dibromohexa-1,3-diene (PubChem CID 90770193) has the molecular formula C6H8Br2 and a molecular weight of 239.94 g/mol. Its IUPAC name is 5,6-dibromohexa-1,3-diene.
| Compound Name | 5,6-dibromohexa-1,3-diene |
|---|---|
| PubChem CID | 90770193 |
| Molecular Formula | C6H8Br2 |
| Molecular Weight | 239.94 g/mol |
| Exact Mass | 237.90 |
| IUPAC Name | 5,6-dibromohexa-1,3-diene |
| SMILES | C=CC=CC(Br)CBr |
| InChI | InChI=1S/C6H8Br2/c1-2-3-4-6(8)5-7/h2-4,6H,1,5H2 |
| InChIKey | STNACBQDNBSSRT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.94 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|