C8H16N2 — CID 123937470
2-buta-1,3-dienylbutane-1,4-diamine (PubChem CID 123937470) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-buta-1,3-dienylbutane-1,4-diamine.
| Compound Name | 2-buta-1,3-dienylbutane-1,4-diamine |
|---|---|
| PubChem CID | 123937470 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2-buta-1,3-dienylbutane-1,4-diamine |
| SMILES | C=CC=CC(CN)CCN |
| InChI | InChI=1S/C8H16N2/c1-2-3-4-8(7-10)5-6-9/h2-4,8H,1,5-7,9-10H2 |
| InChIKey | KQHJSUOGEUDQSS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|