About 2-buta-1,3-dienylbutane-1,4-diamine
2-buta-1,3-dienylbutane-1,4-diamine (PubChem CID 123937470) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2-buta-1,3-dienylbutane-1,4-diamine.
Molecular Properties
| Compound Name | 2-buta-1,3-dienylbutane-1,4-diamine |
| PubChem CID | 123937470 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2-buta-1,3-dienylbutane-1,4-diamine |
| SMILES | C=CC=CC(CN)CCN |
| InChI | InChI=1S/C8H16N2/c1-2-3-4-8(7-10)5-6-9/h2-4,8H,1,5-7,9-10H2 |
| InChIKey | KQHJSUOGEUDQSS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-buta-1,3-dienylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,3-dienylbutane-1,4-diamine?
The IUPAC name of 2-buta-1,3-dienylbutane-1,4-diamine (CID 123937470) is 2-buta-1,3-dienylbutane-1,4-diamine.
What is the SMILES notation for 2-buta-1,3-dienylbutane-1,4-diamine?
The canonical SMILES for 2-buta-1,3-dienylbutane-1,4-diamine is C=CC=CC(CN)CCN.
What is the InChIKey of 2-buta-1,3-dienylbutane-1,4-diamine?
The InChIKey is KQHJSUOGEUDQSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-2-3-4-8(7-10)5-6-9/h2-4,8H,1,5-7,9-10H2.
What are the key properties of 2-buta-1,3-dienylbutane-1,4-diamine?
2-buta-1,3-dienylbutane-1,4-diamine has a molecular weight of 140.23 g/mol, XLogP of 0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,3-dienylbutane-1,4-diamine is sourced from PubChem (CID 123937470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).