C7H14N2 — CID 174506630
2-propa-1,2-dienylbutane-1,4-diamine (PubChem CID 174506630) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2-propa-1,2-dienylbutane-1,4-diamine.
| Compound Name | 2-propa-1,2-dienylbutane-1,4-diamine |
|---|---|
| PubChem CID | 174506630 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2-propa-1,2-dienylbutane-1,4-diamine |
| SMILES | C=C=CC(CN)CCN |
| InChI | InChI=1S/C7H14N2/c1-2-3-7(6-9)4-5-8/h3,7H,1,4-6,8-9H2 |
| InChIKey | GBBHVMVRJQZOLF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |