About 2-chlorobutane-1,4-diamine
2-chlorobutane-1,4-diamine (PubChem CID 18330832) has the molecular formula C4H11ClN2
and a molecular weight of 122.60 g/mol. Its IUPAC name is 2-chlorobutane-1,4-diamine.
Molecular Properties
| Compound Name | 2-chlorobutane-1,4-diamine |
| PubChem CID | 18330832 |
| Molecular Formula | C4H11ClN2 |
| Molecular Weight | 122.60 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 2-chlorobutane-1,4-diamine |
| SMILES | NCCC(Cl)CN |
| InChI | InChI=1S/C4H11ClN2/c5-4(3-7)1-2-6/h4H,1-3,6-7H2 |
| InChIKey | SPQUTSJPCKQVLP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.60 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobutane-1,4-diamine?
The IUPAC name of 2-chlorobutane-1,4-diamine (CID 18330832) is 2-chlorobutane-1,4-diamine.
What is the SMILES notation for 2-chlorobutane-1,4-diamine?
The canonical SMILES for 2-chlorobutane-1,4-diamine is NCCC(Cl)CN.
What is the InChIKey of 2-chlorobutane-1,4-diamine?
The InChIKey is SPQUTSJPCKQVLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11ClN2/c5-4(3-7)1-2-6/h4H,1-3,6-7H2.
What are the key properties of 2-chlorobutane-1,4-diamine?
2-chlorobutane-1,4-diamine has a molecular weight of 122.60 g/mol, XLogP of -0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobutane-1,4-diamine is sourced from PubChem (CID 18330832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).