About 2-bromopentane-1,5-diamine
2-bromopentane-1,5-diamine (PubChem CID 12531043) has the molecular formula C5H13BrN2
and a molecular weight of 181.08 g/mol. Its IUPAC name is 2-bromopentane-1,5-diamine.
Molecular Properties
| Compound Name | 2-bromopentane-1,5-diamine |
| PubChem CID | 12531043 |
| Molecular Formula | C5H13BrN2 |
| Molecular Weight | 181.08 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 2-bromopentane-1,5-diamine |
| SMILES | NCCCC(Br)CN |
| InChI | InChI=1S/C5H13BrN2/c6-5(4-8)2-1-3-7/h5H,1-4,7-8H2 |
| InChIKey | QBJPMMHTJIVRCL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.08 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopentane-1,5-diamine?
The IUPAC name of 2-bromopentane-1,5-diamine (CID 12531043) is 2-bromopentane-1,5-diamine.
What is the SMILES notation for 2-bromopentane-1,5-diamine?
The canonical SMILES for 2-bromopentane-1,5-diamine is NCCCC(Br)CN.
What is the InChIKey of 2-bromopentane-1,5-diamine?
The InChIKey is QBJPMMHTJIVRCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13BrN2/c6-5(4-8)2-1-3-7/h5H,1-4,7-8H2.
What are the key properties of 2-bromopentane-1,5-diamine?
2-bromopentane-1,5-diamine has a molecular weight of 181.08 g/mol, XLogP of 0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopentane-1,5-diamine is sourced from PubChem (CID 12531043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).