About (4S)-4-(aminomethyl)octane-1,8-diamine
(4S)-4-(aminomethyl)octane-1,8-diamine (PubChem CID 86309254) has the molecular formula C9H23N3
and a molecular weight of 173.30 g/mol. Its IUPAC name is (4S)-4-(aminomethyl)octane-1,8-diamine.
Molecular Properties
| Compound Name | (4S)-4-(aminomethyl)octane-1,8-diamine |
| PubChem CID | 86309254 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | (4S)-4-(aminomethyl)octane-1,8-diamine |
| SMILES | NCCCC[C@H](CN)CCCN |
| InChI | InChI=1S/C9H23N3/c10-6-2-1-4-9(8-12)5-3-7-11/h9H,1-8,10-12H2/t9-/m0/s1 |
| InChIKey | HMJBXEZHJUYJQY-VIFPVBQESA-N |
| XLogP | 0.43 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(aminomethyl)octane-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(aminomethyl)octane-1,8-diamine?
The IUPAC name of (4S)-4-(aminomethyl)octane-1,8-diamine (CID 86309254) is (4S)-4-(aminomethyl)octane-1,8-diamine.
What is the SMILES notation for (4S)-4-(aminomethyl)octane-1,8-diamine?
The canonical SMILES for (4S)-4-(aminomethyl)octane-1,8-diamine is NCCCC[C@H](CN)CCCN.
What is the InChIKey of (4S)-4-(aminomethyl)octane-1,8-diamine?
The InChIKey is HMJBXEZHJUYJQY-VIFPVBQESA-N. The full InChI is InChI=1S/C9H23N3/c10-6-2-1-4-9(8-12)5-3-7-11/h9H,1-8,10-12H2/t9-/m0/s1.
What are the key properties of (4S)-4-(aminomethyl)octane-1,8-diamine?
(4S)-4-(aminomethyl)octane-1,8-diamine has a molecular weight of 173.30 g/mol, XLogP of 0.43, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(aminomethyl)octane-1,8-diamine is sourced from PubChem (CID 86309254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).