About 2-bromopropane-1,3-diamine;dihydrobromide
2-bromopropane-1,3-diamine;dihydrobromide (PubChem CID 517709) has the molecular formula C3H11Br3N2
and a molecular weight of 314.85 g/mol. Its IUPAC name is 2-bromopropane-1,3-diamine;dihydrobromide.
Molecular Properties
| Compound Name | 2-bromopropane-1,3-diamine;dihydrobromide |
| PubChem CID | 517709 |
| Molecular Formula | C3H11Br3N2 |
| Molecular Weight | 314.85 g/mol |
| Exact Mass | 311.85 |
| IUPAC Name | 2-bromopropane-1,3-diamine;dihydrobromide |
| SMILES | Br.Br.NCC(Br)CN |
| InChI | InChI=1S/C3H9BrN2.2BrH/c4-3(1-5)2-6;;/h3H,1-2,5-6H2;2*1H |
| InChIKey | WRUBPFGIQCAWBB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.85 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromopropane-1,3-diamine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromopropane-1,3-diamine;dihydrobromide?
The IUPAC name of 2-bromopropane-1,3-diamine;dihydrobromide (CID 517709) is 2-bromopropane-1,3-diamine;dihydrobromide.
What is the SMILES notation for 2-bromopropane-1,3-diamine;dihydrobromide?
The canonical SMILES for 2-bromopropane-1,3-diamine;dihydrobromide is Br.Br.NCC(Br)CN.
What is the InChIKey of 2-bromopropane-1,3-diamine;dihydrobromide?
The InChIKey is WRUBPFGIQCAWBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9BrN2.2BrH/c4-3(1-5)2-6;;/h3H,1-2,5-6H2;2*1H.
What are the key properties of 2-bromopropane-1,3-diamine;dihydrobromide?
2-bromopropane-1,3-diamine;dihydrobromide has a molecular weight of 314.85 g/mol, XLogP of 0.82, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromopropane-1,3-diamine;dihydrobromide is sourced from PubChem (CID 517709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).