C2H7Br2N — CID 76974623
2-bromo-1,1,2,2-tetradeuterioethanamine;hydrobromide (PubChem CID 76974623) has the molecular formula C2H7Br2N and a molecular weight of 208.92 g/mol. Its IUPAC name is 2-bromo-1,1,2,2-tetradeuterioethanamine;hydrobromide.
| Compound Name | 2-bromo-1,1,2,2-tetradeuterioethanamine;hydrobromide |
|---|---|
| PubChem CID | 76974623 |
| Molecular Formula | C2H7Br2N |
| Molecular Weight | 208.92 g/mol |
| Exact Mass | 206.92 |
| IUPAC Name | 2-bromo-1,1,2,2-tetradeuterioethanamine;hydrobromide |
| SMILES | Br.[2H]C([2H])(N)C([2H])([2H])Br |
| InChI | InChI=1S/C2H6BrN.BrH/c3-1-2-4;/h1-2,4H2;1H/i1D2,2D2; |
| InChIKey | WJAXXWSZNSFVNG-PBCJVBLFSA-N |
| XLogP | 0.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.92 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|