C5H10Br2 — CID 131869331
1,5-dibromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentane (PubChem CID 131869331) has the molecular formula C5H10Br2 and a molecular weight of 240.00 g/mol. Its IUPAC name is 1,5-dibromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentane.
| Compound Name | 1,5-dibromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentane |
|---|---|
| PubChem CID | 131869331 |
| Molecular Formula | C5H10Br2 |
| Molecular Weight | 240.00 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 1,5-dibromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentane |
| SMILES | [2H]C([2H])(Br)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
| InChI | InChI=1S/C5H10Br2/c6-4-2-1-3-5-7/h1-5H2/i1D2,2D2,3D2,4D2,5D2 |
| InChIKey | IBODDUNKEPPBKW-YXALHFAPSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.00 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|