About 1-bromo-7,7-dideuterioundecane
1-bromo-7,7-dideuterioundecane (PubChem CID 11075452) has the molecular formula C11H23Br
and a molecular weight of 237.22 g/mol. Its IUPAC name is 1-bromo-7,7-dideuterioundecane.
Molecular Properties
| Compound Name | 1-bromo-7,7-dideuterioundecane |
| PubChem CID | 11075452 |
| Molecular Formula | C11H23Br |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-bromo-7,7-dideuterioundecane |
| SMILES | [2H]C([2H])(CCCC)CCCCCCBr |
| InChI | InChI=1S/C11H23Br/c1-2-3-4-5-6-7-8-9-10-11-12/h2-11H2,1H3/i5D2 |
| InChIKey | IKPSIIAXIDAQLG-BFWBPSQCSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-7,7-dideuterioundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-7,7-dideuterioundecane?
The IUPAC name of 1-bromo-7,7-dideuterioundecane (CID 11075452) is 1-bromo-7,7-dideuterioundecane.
What is the SMILES notation for 1-bromo-7,7-dideuterioundecane?
The canonical SMILES for 1-bromo-7,7-dideuterioundecane is [2H]C([2H])(CCCC)CCCCCCBr.
What is the InChIKey of 1-bromo-7,7-dideuterioundecane?
The InChIKey is IKPSIIAXIDAQLG-BFWBPSQCSA-N. The full InChI is InChI=1S/C11H23Br/c1-2-3-4-5-6-7-8-9-10-11-12/h2-11H2,1H3/i5D2.
What are the key properties of 1-bromo-7,7-dideuterioundecane?
1-bromo-7,7-dideuterioundecane has a molecular weight of 237.22 g/mol, XLogP of 4.91, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-7,7-dideuterioundecane is sourced from PubChem (CID 11075452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).