C10H21Br — CID 71308869
10-bromo-1,1,1-trideuteriodecane (PubChem CID 71308869) has the molecular formula C10H21Br and a molecular weight of 224.20 g/mol. Its IUPAC name is 10-bromo-1,1,1-trideuteriodecane.
| Compound Name | 10-bromo-1,1,1-trideuteriodecane |
|---|---|
| PubChem CID | 71308869 |
| Molecular Formula | C10H21Br |
| Molecular Weight | 224.20 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 10-bromo-1,1,1-trideuteriodecane |
| SMILES | [2H]C([2H])([2H])CCCCCCCCCBr |
| InChI | InChI=1S/C10H21Br/c1-2-3-4-5-6-7-8-9-10-11/h2-10H2,1H3/i1D3 |
| InChIKey | MYMSJFSOOQERIO-FIBGUPNXSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.20 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|