C3H7Br — CID 87158704
3-bromo-1,1,1,2,2-pentadeuteriopropane (PubChem CID 87158704) has the molecular formula C3H7Br and a molecular weight of 128.02 g/mol. Its IUPAC name is 3-bromo-1,1,1,2,2-pentadeuteriopropane.
| Compound Name | 3-bromo-1,1,1,2,2-pentadeuteriopropane |
|---|---|
| PubChem CID | 87158704 |
| Molecular Formula | C3H7Br |
| Molecular Weight | 128.02 g/mol |
| Exact Mass | 127.00 |
| IUPAC Name | 3-bromo-1,1,1,2,2-pentadeuteriopropane |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CBr |
| InChI | InChI=1S/C3H7Br/c1-2-3-4/h2-3H2,1H3/i1D3,2D2 |
| InChIKey | CYNYIHKIEHGYOZ-ZBJDZAJPSA-N |
| XLogP | 1.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 4 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.02 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|