C3H10ClN — CID 90472115
1,1,2,2,3,3,3-heptadeuteriopropan-1-amine;hydrochloride (PubChem CID 90472115) has the molecular formula C3H10ClN and a molecular weight of 102.62 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptadeuteriopropan-1-amine;hydrochloride.
| Compound Name | 1,1,2,2,3,3,3-heptadeuteriopropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 90472115 |
| Molecular Formula | C3H10ClN |
| Molecular Weight | 102.62 g/mol |
| Exact Mass | 102.09 |
| IUPAC Name | 1,1,2,2,3,3,3-heptadeuteriopropan-1-amine;hydrochloride |
| SMILES | Cl.[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])N |
| InChI | InChI=1S/C3H9N.ClH/c1-2-3-4;/h2-4H2,1H3;1H/i1D3,2D2,3D2; |
| InChIKey | PYNUOAIJIQGACY-DEPOAORMSA-N |
| XLogP | 0.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.62 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |