C6H11NaO2 — CID 90472108
sodium 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate (PubChem CID 90472108) has the molecular formula C6H11NaO2 and a molecular weight of 149.21 g/mol. Its IUPAC name is sodium 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate.
| Compound Name | sodium 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate |
|---|---|
| PubChem CID | 90472108 |
| Molecular Formula | C6H11NaO2 |
| Molecular Weight | 149.21 g/mol |
| Exact Mass | 149.13 |
| IUPAC Name | sodium 2,2,3,3,4,4,5,5,6,6,6-undecadeuteriohexanoate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H12O2.Na/c1-2-3-4-5-6(7)8;/h2-5H2,1H3,(H,7,8);/q;+1/p-1/i1D3,2D2,3D2,4D2,5D2; |
| InChIKey | UDWXLZLRRVQONG-PRPJRVKYSA-M |
| XLogP | -2.68 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.21 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |