C4H7NaO2 — CID 90470969
sodium 3,3,4,4,4-pentadeuteriobutanoate (PubChem CID 90470969) has the molecular formula C4H7NaO2 and a molecular weight of 115.12 g/mol. Its IUPAC name is sodium 3,3,4,4,4-pentadeuteriobutanoate.
| Compound Name | sodium 3,3,4,4,4-pentadeuteriobutanoate |
|---|---|
| PubChem CID | 90470969 |
| Molecular Formula | C4H7NaO2 |
| Molecular Weight | 115.12 g/mol |
| Exact Mass | 115.07 |
| IUPAC Name | sodium 3,3,4,4,4-pentadeuteriobutanoate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H8O2.Na/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);/q;+1/p-1/i1D3,2D2; |
| InChIKey | MFBOGIVSZKQAPD-LUIAAVAXSA-M |
| XLogP | -3.46 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.12 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |