C5H9NaO2 — CID 172990096
sodium 2,2,3,3,4,4,5,5,5-nonadeuteriopentanoate (PubChem CID 172990096) has the molecular formula C5H9NaO2 and a molecular weight of 133.17 g/mol. Its IUPAC name is sodium 2,2,3,3,4,4,5,5,5-nonadeuteriopentanoate.
| Compound Name | sodium 2,2,3,3,4,4,5,5,5-nonadeuteriopentanoate |
|---|---|
| PubChem CID | 172990096 |
| Molecular Formula | C5H9NaO2 |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | sodium 2,2,3,3,4,4,5,5,5-nonadeuteriopentanoate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H10O2.Na/c1-2-3-4-5(6)7;/h2-4H2,1H3,(H,6,7);/q;+1/p-1/i1D3,2D2,3D2,4D2; |
| InChIKey | LHYPLJGBYPAQAK-SRKCJUICSA-M |
| XLogP | -3.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |