C6H12NaO2 — CID 131878087
CID 131878087 (PubChem CID 131878087) has the molecular formula C6H12NaO2 and a molecular weight of 150.22 g/mol.
| Compound Name | CID 131878087 |
|---|---|
| PubChem CID | 131878087 |
| Molecular Formula | C6H12NaO2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O.[Na] |
| InChI | InChI=1S/C6H12O2.Na/c1-2-3-4-5-6(7)8;/h2-5H2,1H3,(H,7,8);/i1D3,2D2,3D2,4D2,5D2; |
| InChIKey | BVAAYLKACPDWPX-PRPJRVKYSA-N |
| XLogP | 1.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |