2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid

C7H12O3 — CID 132990720

IUPAC2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid
SMILES[2H]C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O
InChIInChI=1S/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10)/i1D3,2D2,3D2,4D2,5D2
InChIKeyIZOQMUVIDMLRDC-GILSBCIXSA-N
MW155.24 g/mol
LogP1.22
Rot. Bonds6

About 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid

2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid (PubChem CID 132990720) has the molecular formula C7H12O3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid.

Molecular Properties

Compound Name2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid
PubChem CID132990720
Molecular FormulaC7H12O3
Molecular Weight155.24 g/mol
Exact Mass155.15
IUPAC Name2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid
SMILES[2H]C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O
InChIInChI=1S/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10)/i1D3,2D2,3D2,4D2,5D2
InChIKeyIZOQMUVIDMLRDC-GILSBCIXSA-N
XLogP1.22
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.24
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid?
The IUPAC name of 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid (CID 132990720) is 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid.
What is the SMILES notation for 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid?
The canonical SMILES for 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid is [2H]C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O.
What is the InChIKey of 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid?
The InChIKey is IZOQMUVIDMLRDC-GILSBCIXSA-N. The full InChI is InChI=1S/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10)/i1D3,2D2,3D2,4D2,5D2.
What are the key properties of 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid?
2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid has a molecular weight of 155.24 g/mol, XLogP of 1.22, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid is sourced from PubChem (CID 132990720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).