C7H12O3 — CID 132990720
2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid (PubChem CID 132990720) has the molecular formula C7H12O3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 132990720 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.15 |
| IUPAC Name | 2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C7H12O3/c1-6(8)4-2-3-5-7(9)10/h2-5H2,1H3,(H,9,10)/i1D3,2D2,3D2,4D2,5D2 |
| InChIKey | IZOQMUVIDMLRDC-GILSBCIXSA-N |
| XLogP | 1.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |