C6H12O3 — CID 71309827
2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid (PubChem CID 71309827) has the molecular formula C6H12O3 and a molecular weight of 142.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 71309827 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid |
| SMILES | [2H]C([2H])(O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/i1D2,2D2,3D2,4D2,5D2 |
| InChIKey | IWHLYPDWHHPVAA-YXALHFAPSA-N |
| XLogP | 0.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |