2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid

C6H12O3 — CID 71309827

IUPAC2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid
SMILES[2H]C([2H])(O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O
InChIInChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/i1D2,2D2,3D2,4D2,5D2
InChIKeyIWHLYPDWHHPVAA-YXALHFAPSA-N
MW142.22 g/mol
LogP0.62
Rot. Bonds5

About 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid

2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid (PubChem CID 71309827) has the molecular formula C6H12O3 and a molecular weight of 142.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid.

Molecular Properties

Compound Name2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid
PubChem CID71309827
Molecular FormulaC6H12O3
Molecular Weight142.22 g/mol
Exact Mass142.14
IUPAC Name2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid
SMILES[2H]C([2H])(O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O
InChIInChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/i1D2,2D2,3D2,4D2,5D2
InChIKeyIWHLYPDWHHPVAA-YXALHFAPSA-N
XLogP0.62
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.22
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid?
The IUPAC name of 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid (CID 71309827) is 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid.
What is the SMILES notation for 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid?
The canonical SMILES for 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid is [2H]C([2H])(O)C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O.
What is the InChIKey of 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid?
The InChIKey is IWHLYPDWHHPVAA-YXALHFAPSA-N. The full InChI is InChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/i1D2,2D2,3D2,4D2,5D2.
What are the key properties of 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid?
2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid has a molecular weight of 142.22 g/mol, XLogP of 0.62, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid is sourced from PubChem (CID 71309827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).