2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid

C4H8O3 — CID 73387054

IUPAC2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid
SMILES[2H]C(O)C([2H])([2H])C([2H])([2H])C(=O)O
InChIInChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/i1D2,2D2,3D
InChIKeySJZRECIVHVDYJC-UXXIZXEISA-N
MW109.14 g/mol
LogP-0.16
Rot. Bonds3

About 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid

2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid (PubChem CID 73387054) has the molecular formula C4H8O3 and a molecular weight of 109.14 g/mol. Its IUPAC name is 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid.

Molecular Properties

Compound Name2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid
PubChem CID73387054
Molecular FormulaC4H8O3
Molecular Weight109.14 g/mol
Exact Mass109.08
IUPAC Name2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid
SMILES[2H]C(O)C([2H])([2H])C([2H])([2H])C(=O)O
InChIInChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/i1D2,2D2,3D
InChIKeySJZRECIVHVDYJC-UXXIZXEISA-N
XLogP-0.16
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500109.14
LogP ≤ 5-0.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,2,3,3,4,4-hexadeuteriopentanedioic acid
CID 56845854
2,2,3,3,4,4,5,5,6,6-decadeuterio-6-hydroxyhexanoic acid
CID 71309827
2,2,3,3-tetradeuteriobutanedioic acid
CID 12998487
3,3,4-trideuterio-4-hydroxybutanoic acid
CID 73387053
(4R)-4-amino-2,2,3,3,4-pentadeuteriobutanoic acid
CID 159995067
6-amino-2,2,3,3,4,4-hexadeuteriohexanoic acid
CID 46243937
2,2,3,3,4,4,5,5,7,7,7-undecadeuterio-6-oxoheptanoic acid
CID 132990720
2,2-dideuteriobutanedioic acid
CID 87143155
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19,20,20,21,21,22,22,23,23,24,24,24-heptatetracontadeuteriotetracosanoic acid
CID 102352988
CID 131878087
CID 131878087
2,2,3,3,4,4-hexadeuterio-4-(trideuteriomethylamino)butanoic acid
CID 87379327
2,2,3,3,4,4-hexadeuterio-4-(2,6-dideuteriophenyl)butanoic acid
CID 135037925

Frequently Asked Questions

What is the IUPAC name of 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid?
The IUPAC name of 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid (CID 73387054) is 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid.
What is the SMILES notation for 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid?
The canonical SMILES for 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid is [2H]C(O)C([2H])([2H])C([2H])([2H])C(=O)O.
What is the InChIKey of 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid?
The InChIKey is SJZRECIVHVDYJC-UXXIZXEISA-N. The full InChI is InChI=1S/C4H8O3/c5-3-1-2-4(6)7/h5H,1-3H2,(H,6,7)/i1D2,2D2,3D.
What are the key properties of 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid?
2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid has a molecular weight of 109.14 g/mol, XLogP of -0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,3,4-pentadeuterio-4-hydroxybutanoic acid is sourced from PubChem (CID 73387054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).